C72H140N2O11 — CID 177227006
[2-[5-[cyclohexyl-[2-[2-hydroxyethyl(methyl)amino]ethyl]amino]pentanoyloxymethyl]-3-(6,6-didecoxyhexanoyloxy)propyl] 6,6-didecoxyhexanoate (PubChem CID 177227006) has the molecular formula C72H140N2O11 and a molecular weight of 1209.91 g/mol. Its IUPAC name is [2-[5-[cyclohexyl-[2-[2-hydroxyethyl(methyl)amino]ethyl]amino]pentanoyloxymethyl]-3-(6,6-didecoxyhexanoyloxy)propyl] 6,6-didecoxyhexanoate.
| Compound Name | [2-[5-[cyclohexyl-[2-[2-hydroxyethyl(methyl)amino]ethyl]amino]pentanoyloxymethyl]-3-(6,6-didecoxyhexanoyloxy)propyl] 6,6-didecoxyhexanoate |
|---|---|
| PubChem CID | 177227006 |
| Molecular Formula | C72H140N2O11 |
| Molecular Weight | 1209.91 g/mol |
| Exact Mass | 1209.05 |
| IUPAC Name | [2-[5-[cyclohexyl-[2-[2-hydroxyethyl(methyl)amino]ethyl]amino]pentanoyloxymethyl]-3-(6,6-didecoxyhexanoyloxy)propyl] 6,6-didecoxyhexanoate |
| SMILES | CCCCCCCCCCOC(CCCCC(=O)OCC(COC(=O)CCCCC(OCCCCCCCCCC)OCCCCCCCCCC)COC(=O)CCCCN(CCN(C)CCO)C1CCCCC1)OCCCCCCCCCC |
| InChI | InChI=1S/C72H140N2O11/c1-6-10-14-18-22-26-30-43-59-79-71(80-60-44-31-27-23-19-15-11-7-2)52-39-37-49-68(76)83-63-66(65-85-70(78)51-41-42-54-74(56-55-73(5)57-58-75)67-47-35-34-36-48-67)64-84-69(77)50-38-40-53-72(81-61-45-32-28-24-20-16-12-8-3)82-62-46-33-29-25-21-17-13-9-4/h66-67,71-72,75H,6-65H2,1-5H3 |
| InChIKey | MYQYULGLNSHSCG-UHFFFAOYSA-N |
| XLogP | 18.36 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1209.91 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|