C20H31NO3 — CID 168858355
(2S)-2-amino-3-(1-undec-10-enoylcyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 168858355) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-undec-10-enoylcyclohexa-2,4-dien-1-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(1-undec-10-enoylcyclohexa-2,4-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168858355 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (2S)-2-amino-3-(1-undec-10-enoylcyclohexa-2,4-dien-1-yl)propanoic acid |
| SMILES | C=CCCCCCCCCC(=O)C1(C[C@H](N)C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C20H31NO3/c1-2-3-4-5-6-7-8-10-13-18(22)20(14-11-9-12-15-20)16-17(21)19(23)24/h2,9,11-12,14,17H,1,3-8,10,13,15-16,21H2,(H,23,24)/t17-,20?/m0/s1 |
| InChIKey | FSPRMZCOGUYWBN-DIMJTDRSSA-N |
| XLogP | 4.17 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|