C17H13FN2O3Se — CID 168858800
5-[(3,5-dihydroxyphenyl)methylidene]-3-(4-fluorophenyl)-1-methyl-2-selanylideneimidazolidin-4-one (PubChem CID 168858800) has the molecular formula C17H13FN2O3Se and a molecular weight of 391.26 g/mol. Its IUPAC name is 5-[(3,5-dihydroxyphenyl)methylidene]-3-(4-fluorophenyl)-1-methyl-2-selanylideneimidazolidin-4-one.
| Compound Name | 5-[(3,5-dihydroxyphenyl)methylidene]-3-(4-fluorophenyl)-1-methyl-2-selanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 168858800 |
| Molecular Formula | C17H13FN2O3Se |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 5-[(3,5-dihydroxyphenyl)methylidene]-3-(4-fluorophenyl)-1-methyl-2-selanylideneimidazolidin-4-one |
| SMILES | CN1C(=[Se])N(c2ccc(F)cc2)C(=O)C1=Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H13FN2O3Se/c1-19-15(8-10-6-13(21)9-14(22)7-10)16(23)20(17(19)24)12-4-2-11(18)3-5-12/h2-9,21-22H,1H3 |
| InChIKey | AVQARXGCYPMOMN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|