C23H18N2O3Se — CID 168858792
1-benzyl-5-[(3,5-dihydroxyphenyl)methylidene]-3-phenyl-2-selanylideneimidazolidin-4-one (PubChem CID 168858792) has the molecular formula C23H18N2O3Se and a molecular weight of 449.37 g/mol. Its IUPAC name is 1-benzyl-5-[(3,5-dihydroxyphenyl)methylidene]-3-phenyl-2-selanylideneimidazolidin-4-one.
| Compound Name | 1-benzyl-5-[(3,5-dihydroxyphenyl)methylidene]-3-phenyl-2-selanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 168858792 |
| Molecular Formula | C23H18N2O3Se |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 1-benzyl-5-[(3,5-dihydroxyphenyl)methylidene]-3-phenyl-2-selanylideneimidazolidin-4-one |
| SMILES | O=C1C(=Cc2cc(O)cc(O)c2)N(Cc2ccccc2)C(=[Se])N1c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3Se/c26-19-11-17(12-20(27)14-19)13-21-22(28)25(18-9-5-2-6-10-18)23(29)24(21)15-16-7-3-1-4-8-16/h1-14,26-27H,15H2 |
| InChIKey | GRHRPWBGFCKLGB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|