C17H14N2O3Se — CID 168679458
(5E)-5-[(2,4-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one (PubChem CID 168679458) has the molecular formula C17H14N2O3Se and a molecular weight of 373.27 g/mol. Its IUPAC name is (5E)-5-[(2,4-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(2,4-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 168679458 |
| Molecular Formula | C17H14N2O3Se |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (5E)-5-[(2,4-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one |
| SMILES | CN1C(=[Se])N(c2ccccc2)C(=O)/C1=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C17H14N2O3Se/c1-18-14(9-11-7-8-13(20)10-15(11)21)16(22)19(17(18)23)12-5-3-2-4-6-12/h2-10,20-21H,1H3/b14-9+ |
| InChIKey | RGXSLRQQFBGBIO-NTEUORMPSA-N |
| XLogP | 1.67 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|