C16H22O2S — CID 168860796
4,5-dibutyl-2-(furan-2-yl)furan-3-thiol (PubChem CID 168860796) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4,5-dibutyl-2-(furan-2-yl)furan-3-thiol.
| Compound Name | 4,5-dibutyl-2-(furan-2-yl)furan-3-thiol |
|---|---|
| PubChem CID | 168860796 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4,5-dibutyl-2-(furan-2-yl)furan-3-thiol |
| SMILES | CCCCc1oc(-c2ccco2)c(S)c1CCCC |
| InChI | InChI=1S/C16H22O2S/c1-3-5-8-12-13(9-6-4-2)18-15(16(12)19)14-10-7-11-17-14/h7,10-11,19H,3-6,8-9H2,1-2H3 |
| InChIKey | CSMBBAFJXAOVJU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 26.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|