C26H22FNO3 — CID 168864595
(E)-3-[8-(4-fluorophenyl)-2,2-dimethylchromen-6-yl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 168864595) has the molecular formula C26H22FNO3 and a molecular weight of 415.46 g/mol. Its IUPAC name is (E)-3-[8-(4-fluorophenyl)-2,2-dimethylchromen-6-yl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[8-(4-fluorophenyl)-2,2-dimethylchromen-6-yl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 168864595 |
| Molecular Formula | C26H22FNO3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (E)-3-[8-(4-fluorophenyl)-2,2-dimethylchromen-6-yl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CC1(C)C=Cc2cc(/C=C/C(=O)Nc3ccc(O)cc3)cc(-c3ccc(F)cc3)c2O1 |
| InChI | InChI=1S/C26H22FNO3/c1-26(2)14-13-19-15-17(3-12-24(30)28-21-8-10-22(29)11-9-21)16-23(25(19)31-26)18-4-6-20(27)7-5-18/h3-16,29H,1-2H3,(H,28,30)/b12-3+ |
| InChIKey | ZMFRULAJNGVVRB-KGVSQERTSA-N |
| XLogP | 6.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|