C23H23Cl2FN2O9 — CID 168865259
3-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloro-6-fluorophenoxy]-2-chloro-6-nitrobenzoic acid (PubChem CID 168865259) has the molecular formula C23H23Cl2FN2O9 and a molecular weight of 561.35 g/mol. Its IUPAC name is 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloro-6-fluorophenoxy]-2-chloro-6-nitrobenzoic acid.
| Compound Name | 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloro-6-fluorophenoxy]-2-chloro-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 168865259 |
| Molecular Formula | C23H23Cl2FN2O9 |
| Molecular Weight | 561.35 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | 3-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloro-6-fluorophenoxy]-2-chloro-6-nitrobenzoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc(F)c(Oc2ccc([N+](=O)[O-])c(C(=O)O)c2Cl)c1Cl |
| InChI | InChI=1S/C23H23Cl2FN2O9/c1-22(2,3)36-20(31)27(21(32)37-23(4,5)6)13-8-7-11(26)18(16(13)24)35-14-10-9-12(28(33)34)15(17(14)25)19(29)30/h7-10H,1-6H3,(H,29,30) |
| InChIKey | NIYNRQVPIBHIAD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.35 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|