C16H21N5O2 — CID 168868158
2-methoxy-3-[1-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,2,4-triazol-3-yl]aniline (PubChem CID 168868158) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-methoxy-3-[1-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-methoxy-3-[1-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 168868158 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-methoxy-3-[1-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1c(N)cccc1-c1nc(N2C3CCC2COC3)n(C)n1 |
| InChI | InChI=1S/C16H21N5O2/c1-20-16(21-10-6-7-11(21)9-23-8-10)18-15(19-20)12-4-3-5-13(17)14(12)22-2/h3-5,10-11H,6-9,17H2,1-2H3 |
| InChIKey | DTUKYQQLHBMQAA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|