C11H13FN4O — CID 170439736
3-[1-(2-fluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyaniline (PubChem CID 170439736) has the molecular formula C11H13FN4O and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-[1-(2-fluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyaniline.
| Compound Name | 3-[1-(2-fluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyaniline |
|---|---|
| PubChem CID | 170439736 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-[1-(2-fluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyaniline |
| SMILES | COc1c(N)cccc1-c1ncn(CCF)n1 |
| InChI | InChI=1S/C11H13FN4O/c1-17-10-8(3-2-4-9(10)13)11-14-7-16(15-11)6-5-12/h2-4,7H,5-6,13H2,1H3 |
| InChIKey | JQVJQISOMMFGLU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|