C17H22F3N3O6S — CID 168872983
tert-butyl (2S,4R)-2-formamido-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]pyrrolidine-1-carboxylate (PubChem CID 168872983) has the molecular formula C17H22F3N3O6S and a molecular weight of 453.44 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-formamido-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-formamido-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168872983 |
| Molecular Formula | C17H22F3N3O6S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | tert-butyl (2S,4R)-2-formamido-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NS(=O)(=O)c2ccccc2OC(F)(F)F)C[C@H]1NC=O |
| InChI | InChI=1S/C17H22F3N3O6S/c1-16(2,3)29-15(25)23-9-11(8-14(23)21-10-24)22-30(26,27)13-7-5-4-6-12(13)28-17(18,19)20/h4-7,10-11,14,22H,8-9H2,1-3H3,(H,21,24)/t11-,14+/m1/s1 |
| InChIKey | GZOOZRXFBGKFNG-RISCZKNCSA-N |
| XLogP | 1.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|