C23H23F3N2O5S — CID 25070564
tert-butyl 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylindol-5-yl]azetidine-1-carboxylate (PubChem CID 25070564) has the molecular formula C23H23F3N2O5S and a molecular weight of 496.51 g/mol. Its IUPAC name is tert-butyl 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylindol-5-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylindol-5-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 25070564 |
| Molecular Formula | C23H23F3N2O5S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | tert-butyl 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylindol-5-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc3c(ccn3S(=O)(=O)c3ccccc3OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H23F3N2O5S/c1-22(2,3)33-21(29)27-13-17(14-27)15-8-9-18-16(12-15)10-11-28(18)34(30,31)20-7-5-4-6-19(20)32-23(24,25)26/h4-12,17H,13-14H2,1-3H3 |
| InChIKey | MDUYVIHFIOGVAU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |