About anthra[1,2-c]dioxet-3-ol
anthra[1,2-c]dioxet-3-ol (PubChem CID 168873543) has the molecular formula C14H8O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is anthra[1,2-c]dioxet-3-ol.
Molecular Properties
| Compound Name | anthra[1,2-c]dioxet-3-ol |
| PubChem CID | 168873543 |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | anthra[1,2-c]dioxet-3-ol |
| SMILES | Oc1cc2cc3ccccc3cc2c2ooc12 |
| InChI | InChI=1S/C14H8O3/c15-12-7-10-5-8-3-1-2-4-9(8)6-11(10)13-14(12)17-16-13/h1-7,15H |
| InChIKey | XIJBOFVTSUZZPJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthra[1,2-c]dioxet-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthra[1,2-c]dioxet-3-ol?
The IUPAC name of anthra[1,2-c]dioxet-3-ol (CID 168873543) is anthra[1,2-c]dioxet-3-ol.
What is the SMILES notation for anthra[1,2-c]dioxet-3-ol?
The canonical SMILES for anthra[1,2-c]dioxet-3-ol is Oc1cc2cc3ccccc3cc2c2ooc12.
What is the InChIKey of anthra[1,2-c]dioxet-3-ol?
The InChIKey is XIJBOFVTSUZZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O3/c15-12-7-10-5-8-3-1-2-4-9(8)6-11(10)13-14(12)17-16-13/h1-7,15H.
What are the key properties of anthra[1,2-c]dioxet-3-ol?
anthra[1,2-c]dioxet-3-ol has a molecular weight of 224.22 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anthra[1,2-c]dioxet-3-ol is sourced from PubChem (CID 168873543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).