C24H18F3N3O3S — CID 168873971
N-[(4-benzylsulfanyl-2,6-difluorophenyl)methyl]-6-fluoro-7-methoxy-3-nitroquinolin-4-amine (PubChem CID 168873971) has the molecular formula C24H18F3N3O3S and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[(4-benzylsulfanyl-2,6-difluorophenyl)methyl]-6-fluoro-7-methoxy-3-nitroquinolin-4-amine.
| Compound Name | N-[(4-benzylsulfanyl-2,6-difluorophenyl)methyl]-6-fluoro-7-methoxy-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 168873971 |
| Molecular Formula | C24H18F3N3O3S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[(4-benzylsulfanyl-2,6-difluorophenyl)methyl]-6-fluoro-7-methoxy-3-nitroquinolin-4-amine |
| SMILES | COc1cc2ncc([N+](=O)[O-])c(NCc3c(F)cc(SCc4ccccc4)cc3F)c2cc1F |
| InChI | InChI=1S/C24H18F3N3O3S/c1-33-23-10-21-16(9-20(23)27)24(22(12-28-21)30(31)32)29-11-17-18(25)7-15(8-19(17)26)34-13-14-5-3-2-4-6-14/h2-10,12H,11,13H2,1H3,(H,28,29) |
| InChIKey | IUZSEJZGMWAAIZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|