C14H18OS — CID 168875653
S-butyl 2,3-dihydro-1H-indene-1-carbothioate (PubChem CID 168875653) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is S-butyl 2,3-dihydro-1H-indene-1-carbothioate.
| Compound Name | S-butyl 2,3-dihydro-1H-indene-1-carbothioate |
|---|---|
| PubChem CID | 168875653 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | S-butyl 2,3-dihydro-1H-indene-1-carbothioate |
| SMILES | CCCCSC(=O)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H18OS/c1-2-3-10-16-14(15)13-9-8-11-6-4-5-7-12(11)13/h4-7,13H,2-3,8-10H2,1H3 |
| InChIKey | VUOCFIIGQXPOFR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|