C13H12Cl2N4O2 — CID 168876087
phenyl 2-[[(2,4-dichloropyrimidin-5-yl)amino]methylamino]acetate (PubChem CID 168876087) has the molecular formula C13H12Cl2N4O2 and a molecular weight of 327.17 g/mol. Its IUPAC name is phenyl 2-[[(2,4-dichloropyrimidin-5-yl)amino]methylamino]acetate.
| Compound Name | phenyl 2-[[(2,4-dichloropyrimidin-5-yl)amino]methylamino]acetate |
|---|---|
| PubChem CID | 168876087 |
| Molecular Formula | C13H12Cl2N4O2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | phenyl 2-[[(2,4-dichloropyrimidin-5-yl)amino]methylamino]acetate |
| SMILES | O=C(CNCNc1cnc(Cl)nc1Cl)Oc1ccccc1 |
| InChI | InChI=1S/C13H12Cl2N4O2/c14-12-10(6-17-13(15)19-12)18-8-16-7-11(20)21-9-4-2-1-3-5-9/h1-6,16,18H,7-8H2 |
| InChIKey | KYYGENJFWVYARP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|