C12H21NO — CID 168877570
1-(1-methyl-4-propylpiperidin-2-yl)prop-2-en-1-one (PubChem CID 168877570) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(1-methyl-4-propylpiperidin-2-yl)prop-2-en-1-one.
| Compound Name | 1-(1-methyl-4-propylpiperidin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 168877570 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(1-methyl-4-propylpiperidin-2-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1CC(CCC)CCN1C |
| InChI | InChI=1S/C12H21NO/c1-4-6-10-7-8-13(3)11(9-10)12(14)5-2/h5,10-11H,2,4,6-9H2,1,3H3 |
| InChIKey | AFDUMJCFQGDIEE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|