C11H14O6S — CID 168877618
methyl 3-methyl-5-(oxetan-3-ylmethylsulfonyl)furan-2-carboxylate (PubChem CID 168877618) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is methyl 3-methyl-5-(oxetan-3-ylmethylsulfonyl)furan-2-carboxylate.
| Compound Name | methyl 3-methyl-5-(oxetan-3-ylmethylsulfonyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 168877618 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 3-methyl-5-(oxetan-3-ylmethylsulfonyl)furan-2-carboxylate |
| SMILES | COC(=O)c1oc(S(=O)(=O)CC2COC2)cc1C |
| InChI | InChI=1S/C11H14O6S/c1-7-3-9(17-10(7)11(12)15-2)18(13,14)6-8-4-16-5-8/h3,8H,4-6H2,1-2H3 |
| InChIKey | IQNZWVUXPQECBC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |