C18H36O — CID 168877642
2-(4,4-dimethylpent-2-enyl)-5,7,7-trimethyloctan-1-ol (PubChem CID 168877642) has the molecular formula C18H36O and a molecular weight of 268.48 g/mol. Its IUPAC name is 2-(4,4-dimethylpent-2-enyl)-5,7,7-trimethyloctan-1-ol.
| Compound Name | 2-(4,4-dimethylpent-2-enyl)-5,7,7-trimethyloctan-1-ol |
|---|---|
| PubChem CID | 168877642 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | 2-(4,4-dimethylpent-2-enyl)-5,7,7-trimethyloctan-1-ol |
| SMILES | CC(CCC(CO)CC=CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H36O/c1-15(13-18(5,6)7)10-11-16(14-19)9-8-12-17(2,3)4/h8,12,15-16,19H,9-11,13-14H2,1-7H3 |
| InChIKey | PLCGWGGIGFVKTE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|