C12H27NO2 — CID 154946072
2-amino-6,8,8-trimethylnonane-1,3-diol (PubChem CID 154946072) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 2-amino-6,8,8-trimethylnonane-1,3-diol.
| Compound Name | 2-amino-6,8,8-trimethylnonane-1,3-diol |
|---|---|
| PubChem CID | 154946072 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 2-amino-6,8,8-trimethylnonane-1,3-diol |
| SMILES | CC(CCC(O)C(N)CO)CC(C)(C)C |
| InChI | InChI=1S/C12H27NO2/c1-9(7-12(2,3)4)5-6-11(15)10(13)8-14/h9-11,14-15H,5-8,13H2,1-4H3 |
| InChIKey | GBGNUCLZRHZHSN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |