C16H16ClN3O2S — CID 168878438
5-[6-(3,4-dimethoxyphenyl)pyrazin-2-yl]thiophen-3-amine;hydrochloride (PubChem CID 168878438) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 5-[6-(3,4-dimethoxyphenyl)pyrazin-2-yl]thiophen-3-amine;hydrochloride.
| Compound Name | 5-[6-(3,4-dimethoxyphenyl)pyrazin-2-yl]thiophen-3-amine;hydrochloride |
|---|---|
| PubChem CID | 168878438 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-[6-(3,4-dimethoxyphenyl)pyrazin-2-yl]thiophen-3-amine;hydrochloride |
| SMILES | COc1ccc(-c2cncc(-c3cc(N)cs3)n2)cc1OC.Cl |
| InChI | InChI=1S/C16H15N3O2S.ClH/c1-20-14-4-3-10(5-15(14)21-2)12-7-18-8-13(19-12)16-6-11(17)9-22-16;/h3-9H,17H2,1-2H3;1H |
| InChIKey | UFICEHIDIRKEJY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |