C50H97NO5S — CID 168878532
6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanethioyloxy)hexyl]amino]hexyl 2-hexyldecanoate (PubChem CID 168878532) has the molecular formula C50H97NO5S and a molecular weight of 824.39 g/mol. Its IUPAC name is 6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanethioyloxy)hexyl]amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanethioyloxy)hexyl]amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 168878532 |
| Molecular Formula | C50H97NO5S |
| Molecular Weight | 824.39 g/mol |
| Exact Mass | 823.71 |
| IUPAC Name | 6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanethioyloxy)hexyl]amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=S)C(CCCCCC)CCCCCCCC)CCCC(=O)OCC |
| InChI | InChI=1S/C50H97NO5S/c1-6-11-15-19-21-29-37-46(36-27-17-13-8-3)49(53)55-44-33-25-23-31-41-51(43-35-40-48(52)54-10-5)42-32-24-26-34-45-56-50(57)47(38-28-18-14-9-4)39-30-22-20-16-12-7-2/h46-47H,6-45H2,1-5H3 |
| InChIKey | AEVGPOXJBJDARL-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.39 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|