C50H98NO6+ — CID 176691211
[1-[6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanoyloxy)hexyl]amino]hexoxy]-2-hexyldecylidene]oxidanium (PubChem CID 176691211) has the molecular formula C50H98NO6+ and a molecular weight of 809.33 g/mol. Its IUPAC name is [1-[6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanoyloxy)hexyl]amino]hexoxy]-2-hexyldecylidene]oxidanium.
| Compound Name | [1-[6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanoyloxy)hexyl]amino]hexoxy]-2-hexyldecylidene]oxidanium |
|---|---|
| PubChem CID | 176691211 |
| Molecular Formula | C50H98NO6+ |
| Molecular Weight | 809.33 g/mol |
| Exact Mass | 808.74 |
| IUPAC Name | [1-[6-[(4-ethoxy-4-oxobutyl)-[6-(2-hexyldecanoyloxy)hexyl]amino]hexoxy]-2-hexyldecylidene]oxidanium |
| SMILES | [H]/[O+]=C(\OCCCCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCC(=O)OCC)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H97NO6/c1-6-11-15-19-21-29-38-46(36-27-17-13-8-3)49(53)56-44-33-25-23-31-41-51(43-35-40-48(52)55-10-5)42-32-24-26-34-45-57-50(54)47(37-28-18-14-9-4)39-30-22-20-16-12-7-2/h46-47H,6-45H2,1-5H3/p+1 |
| InChIKey | VRMGPBIVNIRKNN-UHFFFAOYSA-O |
| XLogP | 14.49 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.33 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|