C18H25N2OP — CID 168879430
1-ethenyl-6-methoxy-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole;prop-1-en-2-ylphosphane (PubChem CID 168879430) has the molecular formula C18H25N2OP and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-ethenyl-6-methoxy-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole;prop-1-en-2-ylphosphane.
| Compound Name | 1-ethenyl-6-methoxy-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole;prop-1-en-2-ylphosphane |
|---|---|
| PubChem CID | 168879430 |
| Molecular Formula | C18H25N2OP |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-ethenyl-6-methoxy-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole;prop-1-en-2-ylphosphane |
| SMILES | C=C(C)P.C=CC1(C)NCCc2c1[nH]c1ccc(OC)cc21 |
| InChI | InChI=1S/C15H18N2O.C3H7P/c1-4-15(2)14-11(7-8-16-15)12-9-10(18-3)5-6-13(12)17-14;1-3(2)4/h4-6,9,16-17H,1,7-8H2,2-3H3;1,4H2,2H3 |
| InChIKey | LBSCGKWHEFKAKO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|