C9H12N2 — CID 168882807
(4E)-2-ethyl-5-methylidene-4-prop-2-enylidene-1H-imidazole (PubChem CID 168882807) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (4E)-2-ethyl-5-methylidene-4-prop-2-enylidene-1H-imidazole.
| Compound Name | (4E)-2-ethyl-5-methylidene-4-prop-2-enylidene-1H-imidazole |
|---|---|
| PubChem CID | 168882807 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (4E)-2-ethyl-5-methylidene-4-prop-2-enylidene-1H-imidazole |
| SMILES | C=C/C=c1/nc(CC)[nH]c1=C |
| InChI | InChI=1S/C9H12N2/c1-4-6-8-7(3)10-9(5-2)11-8/h4,6H,1,3,5H2,2H3,(H,10,11)/b8-6+ |
| InChIKey | ULBGSNFKIGSMHG-SOFGYWHQSA-N |
| XLogP | 0.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |