C22H33NO — CID 168883991
ethane;6-ethanimidoyl-5-methylpentacyclo[8.7.0.01,13.02,10.05,9]heptadec-13-en-15-one (PubChem CID 168883991) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is ethane;6-ethanimidoyl-5-methylpentacyclo[8.7.0.01,13.02,10.05,9]heptadec-13-en-15-one.
| Compound Name | ethane;6-ethanimidoyl-5-methylpentacyclo[8.7.0.01,13.02,10.05,9]heptadec-13-en-15-one |
|---|---|
| PubChem CID | 168883991 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | ethane;6-ethanimidoyl-5-methylpentacyclo[8.7.0.01,13.02,10.05,9]heptadec-13-en-15-one |
| SMILES | CC.[H]/N=C(\C)C1CCC2C1(C)CCC1C34CCC(=O)C=C3CCC214 |
| InChI | InChI=1S/C20H27NO.C2H6/c1-12(21)15-3-4-16-18(15,2)8-7-17-19-10-6-14(22)11-13(19)5-9-20(16,17)19;1-2/h11,15-17,21H,3-10H2,1-2H3;1-2H3/b21-12+; |
| InChIKey | HJROPHCKLQIACP-BFVDCFMLSA-N |
| XLogP | 5.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|