C23H37NO — CID 168883632
ethane;(2Z)-2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanylidene)acetaldehyde (PubChem CID 168883632) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is ethane;(2Z)-2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanylidene)acetaldehyde.
| Compound Name | ethane;(2Z)-2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanylidene)acetaldehyde |
|---|---|
| PubChem CID | 168883632 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | ethane;(2Z)-2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanylidene)acetaldehyde |
| SMILES | CC.[H]/N=C(\C)C1CCC2C1(C)CCC1C3(CCC)/C(=C\C=O)CCC213 |
| InChI | InChI=1S/C21H31NO.C2H6/c1-4-10-20-15(9-13-23)7-12-21(20)17-6-5-16(14(2)22)19(17,3)11-8-18(20)21;1-2/h9,13,16-18,22H,4-8,10-12H2,1-3H3;1-2H3/b15-9-,22-14+; |
| InChIKey | QDMACHZWASAJSJ-YSLBMHCASA-N |
| XLogP | 6.20 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|