C22H37NO — CID 168883472
2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanyl)acetaldehyde;methane (PubChem CID 168883472) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanyl)acetaldehyde;methane.
| Compound Name | 2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanyl)acetaldehyde;methane |
|---|---|
| PubChem CID | 168883472 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 2-(5-ethanimidoyl-6-methyl-10-propyl-11-tetracyclo[7.4.0.01,10.02,6]tridecanyl)acetaldehyde;methane |
| SMILES | C.[H]/N=C(\C)C1CCC2C1(C)CCC1C3(CCC)C(CC=O)CCC213 |
| InChI | InChI=1S/C21H33NO.CH4/c1-4-10-20-15(9-13-23)7-12-21(20)17-6-5-16(14(2)22)19(17,3)11-8-18(20)21;/h13,15-18,22H,4-12H2,1-3H3;1H4/b22-14+; |
| InChIKey | BXBWZXFSAHXFEF-CWUUNJJBSA-N |
| XLogP | 5.89 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|