C15H16F3N3O4S2 — CID 168884272
5-[(3S)-3-[(2,2-difluorocyclopropyl)methylamino]-5-fluoro-7-hydroxy-3,4-dihydro-2H-thiochromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 168884272) has the molecular formula C15H16F3N3O4S2 and a molecular weight of 423.44 g/mol. Its IUPAC name is 5-[(3S)-3-[(2,2-difluorocyclopropyl)methylamino]-5-fluoro-7-hydroxy-3,4-dihydro-2H-thiochromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(3S)-3-[(2,2-difluorocyclopropyl)methylamino]-5-fluoro-7-hydroxy-3,4-dihydro-2H-thiochromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 168884272 |
| Molecular Formula | C15H16F3N3O4S2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 5-[(3S)-3-[(2,2-difluorocyclopropyl)methylamino]-5-fluoro-7-hydroxy-3,4-dihydro-2H-thiochromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCC2CC2(F)F)CS3)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H16F3N3O4S2/c16-13-9-1-8(19-4-7-3-15(7,17)18)6-26-11(9)2-10(22)14(13)21-5-12(23)20-27(21,24)25/h2,7-8,19,22H,1,3-6H2,(H,20,23)/t7?,8-/m0/s1 |
| InChIKey | YNIIVGVVEZTAHF-MQWKRIRWSA-N |
| XLogP | 0.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |