C16H26BrN5O2 — CID 168886020
tert-butyl N-[5-[(5-amino-2-bromo-4-pyridinyl)amino]-1-methylpiperidin-3-yl]carbamate (PubChem CID 168886020) has the molecular formula C16H26BrN5O2 and a molecular weight of 400.32 g/mol. Its IUPAC name is tert-butyl N-[5-[(5-amino-2-bromo-4-pyridinyl)amino]-1-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(5-amino-2-bromo-4-pyridinyl)amino]-1-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 168886020 |
| Molecular Formula | C16H26BrN5O2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | tert-butyl N-[5-[(5-amino-2-bromo-4-pyridinyl)amino]-1-methylpiperidin-3-yl]carbamate |
| SMILES | CN1CC(NC(=O)OC(C)(C)C)CC(Nc2cc(Br)ncc2N)C1 |
| InChI | InChI=1S/C16H26BrN5O2/c1-16(2,3)24-15(23)21-11-5-10(8-22(4)9-11)20-13-6-14(17)19-7-12(13)18/h6-7,10-11H,5,8-9,18H2,1-4H3,(H,19,20)(H,21,23) |
| InChIKey | JYWOUNOKSYKQDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|