C21H19F3N8O — CID 168891293
4,12,12-trimethyl-N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxamide (PubChem CID 168891293) has the molecular formula C21H19F3N8O and a molecular weight of 456.43 g/mol. Its IUPAC name is 4,12,12-trimethyl-N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxamide.
| Compound Name | 4,12,12-trimethyl-N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxamide |
|---|---|
| PubChem CID | 168891293 |
| Molecular Formula | C21H19F3N8O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4,12,12-trimethyl-N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxamide |
| SMILES | Cc1cn2ncc3c(c2n1)C(C)(C)CC3C(=O)Nc1cnc(-n2nccn2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N8O/c1-11-10-31-18(29-11)16-14(9-28-31)13(7-20(16,2)3)19(33)30-12-6-15(21(22,23)24)17(25-8-12)32-26-4-5-27-32/h4-6,8-10,13H,7H2,1-3H3,(H,30,33) |
| InChIKey | ZGASQBULUUQDQG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |