C14H17N3O2 — CID 164600345
methyl 4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate (PubChem CID 164600345) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate.
| Compound Name | methyl 4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 164600345 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | methyl 4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate |
| SMILES | COC(=O)C1CC(C)(C)c2c1cnn1cc(C)nc21 |
| InChI | InChI=1S/C14H17N3O2/c1-8-7-17-12(16-8)11-10(6-15-17)9(13(18)19-4)5-14(11,2)3/h6-7,9H,5H2,1-4H3 |
| InChIKey | JMUAQRKIIIXATD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |