C10H18B2N2O2 — CID 168891701
CID 168891701 (PubChem CID 168891701) has the molecular formula C10H18B2N2O2 and a molecular weight of 219.89 g/mol.
| Compound Name | CID 168891701 |
|---|---|
| PubChem CID | 168891701 |
| Molecular Formula | C10H18B2N2O2 |
| Molecular Weight | 219.89 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | — |
| SMILES | [B]N([B])CCCC(=O)NCCC(=O)C(C)C |
| InChI | InChI=1S/C10H18B2N2O2/c1-8(2)9(15)5-6-13-10(16)4-3-7-14(11)12/h8H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | BHAHRYPVQCPYSL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.89 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|