About cyclohexane;1-methanimidoylpyridin-2-imine
cyclohexane;1-methanimidoylpyridin-2-imine (PubChem CID 168893924) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is cyclohexane;1-methanimidoylpyridin-2-imine.
Molecular Properties
| Compound Name | cyclohexane;1-methanimidoylpyridin-2-imine |
| PubChem CID | 168893924 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | cyclohexane;1-methanimidoylpyridin-2-imine |
| SMILES | C1CCCCC1.[H]/N=C/n1cccc/c1=N\[H] |
| InChI | InChI=1S/C6H7N3.C6H12/c7-5-9-4-2-1-3-6(9)8;1-2-4-6-5-3-1/h1-5,7-8H;1-6H2/b7-5+,8-6+; |
| InChIKey | INIUGZVAZPEUDD-PUFOULASSA-N |
| XLogP | 2.76 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;1-methanimidoylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;1-methanimidoylpyridin-2-imine?
The IUPAC name of cyclohexane;1-methanimidoylpyridin-2-imine (CID 168893924) is cyclohexane;1-methanimidoylpyridin-2-imine.
What is the SMILES notation for cyclohexane;1-methanimidoylpyridin-2-imine?
The canonical SMILES for cyclohexane;1-methanimidoylpyridin-2-imine is C1CCCCC1.[H]/N=C/n1cccc/c1=N\[H].
What is the InChIKey of cyclohexane;1-methanimidoylpyridin-2-imine?
The InChIKey is INIUGZVAZPEUDD-PUFOULASSA-N. The full InChI is InChI=1S/C6H7N3.C6H12/c7-5-9-4-2-1-3-6(9)8;1-2-4-6-5-3-1/h1-5,7-8H;1-6H2/b7-5+,8-6+;.
What are the key properties of cyclohexane;1-methanimidoylpyridin-2-imine?
cyclohexane;1-methanimidoylpyridin-2-imine has a molecular weight of 205.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;1-methanimidoylpyridin-2-imine is sourced from PubChem (CID 168893924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).