C12H20N2 — CID 168895439
ethane;1-ethenyl-N,3,5-trimethylpyridin-2-imine (PubChem CID 168895439) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;1-ethenyl-N,3,5-trimethylpyridin-2-imine.
| Compound Name | ethane;1-ethenyl-N,3,5-trimethylpyridin-2-imine |
|---|---|
| PubChem CID | 168895439 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;1-ethenyl-N,3,5-trimethylpyridin-2-imine |
| SMILES | C=Cn1cc(C)cc(C)/c1=N\C.CC |
| InChI | InChI=1S/C10H14N2.C2H6/c1-5-12-7-8(2)6-9(3)10(12)11-4;1-2/h5-7H,1H2,2-4H3;1-2H3/b11-10+; |
| InChIKey | XELYOBWGYKYYEE-ASTDGNLGSA-N |
| XLogP | 2.76 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |