C9H9N5O2S — CID 168901930
2-[(6-aminooxy-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 168901930) has the molecular formula C9H9N5O2S and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[(6-aminooxy-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[(6-aminooxy-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 168901930 |
| Molecular Formula | C9H9N5O2S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[(6-aminooxy-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(Nc2ncc(C=O)s2)cc(ON)n1 |
| InChI | InChI=1S/C9H9N5O2S/c1-5-12-7(2-8(13-5)16-10)14-9-11-3-6(4-15)17-9/h2-4H,10H2,1H3,(H,11,12,13,14) |
| InChIKey | GKQCAOGIDYCRMH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|