C22H25F3N2O — CID 168904866
ethane;4-methyl-3-(2-methylbutylideneamino)-5-[4-(trifluoromethoxy)phenyl]benzonitrile (PubChem CID 168904866) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is ethane;4-methyl-3-(2-methylbutylideneamino)-5-[4-(trifluoromethoxy)phenyl]benzonitrile.
| Compound Name | ethane;4-methyl-3-(2-methylbutylideneamino)-5-[4-(trifluoromethoxy)phenyl]benzonitrile |
|---|---|
| PubChem CID | 168904866 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethane;4-methyl-3-(2-methylbutylideneamino)-5-[4-(trifluoromethoxy)phenyl]benzonitrile |
| SMILES | CC.CCC(C)/C=N/c1cc(C#N)cc(-c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C20H19F3N2O.C2H6/c1-4-13(2)12-25-19-10-15(11-24)9-18(14(19)3)16-5-7-17(8-6-16)26-20(21,22)23;1-2/h5-10,12-13H,4H2,1-3H3;1-2H3/b25-12+; |
| InChIKey | GWDDDOPSRXGPRP-CYUVEUGNSA-N |
| XLogP | 7.21 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|