C16H11ClF2N2O3 — CID 168908036
methyl 4-[(E)-[(4-chloro-2-fluorobenzoyl)hydrazinylidene]methyl]-3-fluorobenzoate (PubChem CID 168908036) has the molecular formula C16H11ClF2N2O3 and a molecular weight of 352.72 g/mol. Its IUPAC name is methyl 4-[(E)-[(4-chloro-2-fluorobenzoyl)hydrazinylidene]methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[(E)-[(4-chloro-2-fluorobenzoyl)hydrazinylidene]methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 168908036 |
| Molecular Formula | C16H11ClF2N2O3 |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | methyl 4-[(E)-[(4-chloro-2-fluorobenzoyl)hydrazinylidene]methyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)c2ccc(Cl)cc2F)c(F)c1 |
| InChI | InChI=1S/C16H11ClF2N2O3/c1-24-16(23)9-2-3-10(13(18)6-9)8-20-21-15(22)12-5-4-11(17)7-14(12)19/h2-8H,1H3,(H,21,22)/b20-8+ |
| InChIKey | ASBYXXGUYCOWMS-DNTJNYDQSA-N |
| XLogP | 3.17 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|