C23H17BrClFN2O5 — CID 168908315
6-bromo-3-(2-chloro-5-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-7-methyl-4-nitroisoindol-1-one (PubChem CID 168908315) has the molecular formula C23H17BrClFN2O5 and a molecular weight of 535.75 g/mol. Its IUPAC name is 6-bromo-3-(2-chloro-5-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-7-methyl-4-nitroisoindol-1-one.
| Compound Name | 6-bromo-3-(2-chloro-5-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-7-methyl-4-nitroisoindol-1-one |
|---|---|
| PubChem CID | 168908315 |
| Molecular Formula | C23H17BrClFN2O5 |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | 6-bromo-3-(2-chloro-5-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]-7-methyl-4-nitroisoindol-1-one |
| SMILES | COc1ccc(CN2C(=O)c3c(C)c(Br)cc([N+](=O)[O-])c3C2(O)c2cc(F)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H17BrClFN2O5/c1-12-17(24)10-19(28(31)32)21-20(12)22(29)27(11-13-3-6-15(33-2)7-4-13)23(21,30)16-9-14(26)5-8-18(16)25/h3-10,30H,11H2,1-2H3 |
| InChIKey | SCTXGBXADFUWOH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|