C17H18ClNO3S — CID 168912006
(E)-2-[(2-chloro-1-benzothiophene-6-carbonyl)amino]-5,5-dimethylhex-3-enoic acid (PubChem CID 168912006) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is (E)-2-[(2-chloro-1-benzothiophene-6-carbonyl)amino]-5,5-dimethylhex-3-enoic acid.
| Compound Name | (E)-2-[(2-chloro-1-benzothiophene-6-carbonyl)amino]-5,5-dimethylhex-3-enoic acid |
|---|---|
| PubChem CID | 168912006 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (E)-2-[(2-chloro-1-benzothiophene-6-carbonyl)amino]-5,5-dimethylhex-3-enoic acid |
| SMILES | CC(C)(C)/C=C/C(NC(=O)c1ccc2cc(Cl)sc2c1)C(=O)O |
| InChI | InChI=1S/C17H18ClNO3S/c1-17(2,3)7-6-12(16(21)22)19-15(20)11-5-4-10-9-14(18)23-13(10)8-11/h4-9,12H,1-3H3,(H,19,20)(H,21,22)/b7-6+ |
| InChIKey | JXVFRPNXEBMPKT-VOTSOKGWSA-N |
| XLogP | 4.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|