C21H25NO3S — CID 168912093
ethyl (E)-5,5-dimethyl-2-[(3-thiophen-2-ylbenzoyl)amino]hex-3-enoate (PubChem CID 168912093) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is ethyl (E)-5,5-dimethyl-2-[(3-thiophen-2-ylbenzoyl)amino]hex-3-enoate.
| Compound Name | ethyl (E)-5,5-dimethyl-2-[(3-thiophen-2-ylbenzoyl)amino]hex-3-enoate |
|---|---|
| PubChem CID | 168912093 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | ethyl (E)-5,5-dimethyl-2-[(3-thiophen-2-ylbenzoyl)amino]hex-3-enoate |
| SMILES | CCOC(=O)C(/C=C/C(C)(C)C)NC(=O)c1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C21H25NO3S/c1-5-25-20(24)17(11-12-21(2,3)4)22-19(23)16-9-6-8-15(14-16)18-10-7-13-26-18/h6-14,17H,5H2,1-4H3,(H,22,23)/b12-11+ |
| InChIKey | UFRQQCRPWRMROF-VAWYXSNFSA-N |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|