C21H25N3O4 — CID 175584223
ethyl 5,5-dimethyl-2-[(4-pyrimidin-2-yloxybenzoyl)amino]hex-3-enoate (PubChem CID 175584223) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 5,5-dimethyl-2-[(4-pyrimidin-2-yloxybenzoyl)amino]hex-3-enoate.
| Compound Name | ethyl 5,5-dimethyl-2-[(4-pyrimidin-2-yloxybenzoyl)amino]hex-3-enoate |
|---|---|
| PubChem CID | 175584223 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethyl 5,5-dimethyl-2-[(4-pyrimidin-2-yloxybenzoyl)amino]hex-3-enoate |
| SMILES | CCOC(=O)C(C=CC(C)(C)C)NC(=O)c1ccc(Oc2ncccn2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-5-27-19(26)17(11-12-21(2,3)4)24-18(25)15-7-9-16(10-8-15)28-20-22-13-6-14-23-20/h6-14,17H,5H2,1-4H3,(H,24,25) |
| InChIKey | QQYZLXBNKRJJSG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|