C19H24N4O3 — CID 168911924
ethyl (E)-5,5-dimethyl-2-[[4-(1,2,4-triazol-4-yl)benzoyl]amino]hex-3-enoate (PubChem CID 168911924) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl (E)-5,5-dimethyl-2-[[4-(1,2,4-triazol-4-yl)benzoyl]amino]hex-3-enoate.
| Compound Name | ethyl (E)-5,5-dimethyl-2-[[4-(1,2,4-triazol-4-yl)benzoyl]amino]hex-3-enoate |
|---|---|
| PubChem CID | 168911924 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl (E)-5,5-dimethyl-2-[[4-(1,2,4-triazol-4-yl)benzoyl]amino]hex-3-enoate |
| SMILES | CCOC(=O)C(/C=C/C(C)(C)C)NC(=O)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-5-26-18(25)16(10-11-19(2,3)4)22-17(24)14-6-8-15(9-7-14)23-12-20-21-13-23/h6-13,16H,5H2,1-4H3,(H,22,24)/b11-10+ |
| InChIKey | WXJGIWMNGSXANK-ZHACJKMWSA-N |
| XLogP | 2.53 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|