C18H16N4O3 — CID 6460869
ethyl 4-[[3-(1,2,4-triazol-4-yl)benzoyl]amino]benzoate (PubChem CID 6460869) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl 4-[[3-(1,2,4-triazol-4-yl)benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(1,2,4-triazol-4-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6460869 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | ethyl 4-[[3-(1,2,4-triazol-4-yl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(-n3cnnc3)c2)cc1 |
| InChI | InChI=1S/C18H16N4O3/c1-2-25-18(24)13-6-8-15(9-7-13)21-17(23)14-4-3-5-16(10-14)22-11-19-20-12-22/h3-12H,2H2,1H3,(H,21,23) |
| InChIKey | YBAKLOBUCSAIDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |