C20H21ClN2O4 — CID 168912024
(E)-2-[[6-(4-chlorophenoxy)pyridine-3-carbonyl]amino]-5,5-dimethylhex-3-enoic acid (PubChem CID 168912024) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is (E)-2-[[6-(4-chlorophenoxy)pyridine-3-carbonyl]amino]-5,5-dimethylhex-3-enoic acid.
| Compound Name | (E)-2-[[6-(4-chlorophenoxy)pyridine-3-carbonyl]amino]-5,5-dimethylhex-3-enoic acid |
|---|---|
| PubChem CID | 168912024 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (E)-2-[[6-(4-chlorophenoxy)pyridine-3-carbonyl]amino]-5,5-dimethylhex-3-enoic acid |
| SMILES | CC(C)(C)/C=C/C(NC(=O)c1ccc(Oc2ccc(Cl)cc2)nc1)C(=O)O |
| InChI | InChI=1S/C20H21ClN2O4/c1-20(2,3)11-10-16(19(25)26)23-18(24)13-4-9-17(22-12-13)27-15-7-5-14(21)6-8-15/h4-12,16H,1-3H3,(H,23,24)(H,25,26)/b11-10+ |
| InChIKey | XYPVFBJVIGNUEP-ZHACJKMWSA-N |
| XLogP | 4.31 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|