C25H23N3O4 — CID 168912112
N-methyl-2-oxo-2-[4-phenylmethoxy-1-(phenylmethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetamide (PubChem CID 168912112) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-methyl-2-oxo-2-[4-phenylmethoxy-1-(phenylmethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetamide.
| Compound Name | N-methyl-2-oxo-2-[4-phenylmethoxy-1-(phenylmethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 168912112 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-methyl-2-oxo-2-[4-phenylmethoxy-1-(phenylmethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetamide |
| SMILES | CNC(=O)C(=O)c1cn(COCc2ccccc2)c2nccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C25H23N3O4/c1-26-25(30)23(29)20-14-28(17-31-15-18-8-4-2-5-9-18)24-22(20)21(12-13-27-24)32-16-19-10-6-3-7-11-19/h2-14H,15-17H2,1H3,(H,26,30) |
| InChIKey | FNYZVHUWZLFLFR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|