C10H20N2O — CID 168912689
6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine;ethane (PubChem CID 168912689) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine;ethane.
| Compound Name | 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine;ethane |
|---|---|
| PubChem CID | 168912689 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine;ethane |
| SMILES | CC.CC.c1cn2c(n1)COCC2 |
| InChI | InChI=1S/C6H8N2O.2C2H6/c1-2-8-3-4-9-5-6(8)7-1;2*1-2/h1-2H,3-5H2;2*1-2H3 |
| InChIKey | CHYNCNXHDXZSBX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |