C5H6N4 — CID 57032104
5,8-dihydroimidazo[1,2-d][1,2,4]triazine (PubChem CID 57032104) has the molecular formula C5H6N4 and a molecular weight of 122.13 g/mol. Its IUPAC name is 5,8-dihydroimidazo[1,2-d][1,2,4]triazine.
| Compound Name | 5,8-dihydroimidazo[1,2-d][1,2,4]triazine |
|---|---|
| PubChem CID | 57032104 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 5,8-dihydroimidazo[1,2-d][1,2,4]triazine |
| SMILES | c1cn2c(n1)CN=NC2 |
| InChI | InChI=1S/C5H6N4/c1-2-9-4-8-7-3-5(9)6-1/h1-2H,3-4H2 |
| InChIKey | AAGVSCQYADQQLR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |