About (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid
(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid (PubChem CID 96635834) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid.
Molecular Properties
| Compound Name | (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid |
| PubChem CID | 96635834 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2nccn2C1 |
| InChI | InChI=1S/C7H8N2O2/c10-7(11)5-3-6-8-1-2-9(6)4-5/h1-2,5H,3-4H2,(H,10,11)/t5-/m1/s1 |
| InChIKey | LVDIWOAWCUVNEP-RXMQYKEDSA-N |
| XLogP | 0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The IUPAC name of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid (CID 96635834) is (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid.
What is the SMILES notation for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The canonical SMILES for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid is O=C(O)[C@@H]1Cc2nccn2C1.
What is the InChIKey of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The InChIKey is LVDIWOAWCUVNEP-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H8N2O2/c10-7(11)5-3-6-8-1-2-9(6)4-5/h1-2,5H,3-4H2,(H,10,11)/t5-/m1/s1.
What are the key properties of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid has a molecular weight of 152.15 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid is sourced from PubChem (CID 96635834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).