(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid

C7H8N2O2 — CID 96635834

IUPAC(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid
SMILESO=C(O)[C@@H]1Cc2nccn2C1
InChIInChI=1S/C7H8N2O2/c10-7(11)5-3-6-8-1-2-9(6)4-5/h1-2,5H,3-4H2,(H,10,11)/t5-/m1/s1
InChIKeyLVDIWOAWCUVNEP-RXMQYKEDSA-N
MW152.15 g/mol
LogP0.14
Rot. Bonds1

About (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid

(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid (PubChem CID 96635834) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid.

Molecular Properties

Compound Name(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid
PubChem CID96635834
Molecular FormulaC7H8N2O2
Molecular Weight152.15 g/mol
Exact Mass152.06
IUPAC Name(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid
SMILESO=C(O)[C@@H]1Cc2nccn2C1
InChIInChI=1S/C7H8N2O2/c10-7(11)5-3-6-8-1-2-9(6)4-5/h1-2,5H,3-4H2,(H,10,11)/t5-/m1/s1
InChIKeyLVDIWOAWCUVNEP-RXMQYKEDSA-N
XLogP0.14
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 50.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The IUPAC name of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid (CID 96635834) is (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid.
What is the SMILES notation for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The canonical SMILES for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid is O=C(O)[C@@H]1Cc2nccn2C1.
What is the InChIKey of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
The InChIKey is LVDIWOAWCUVNEP-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H8N2O2/c10-7(11)5-3-6-8-1-2-9(6)4-5/h1-2,5H,3-4H2,(H,10,11)/t5-/m1/s1.
What are the key properties of (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid?
(6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid has a molecular weight of 152.15 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-carboxylic acid is sourced from PubChem (CID 96635834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).