About (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol
(6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol (PubChem CID 10855545) has the molecular formula C6H8N2S
and a molecular weight of 140.21 g/mol. Its IUPAC name is (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol.
Molecular Properties
| Compound Name | (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol |
| PubChem CID | 10855545 |
| Molecular Formula | C6H8N2S |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol |
| SMILES | S[C@H]1Cc2nccn2C1 |
| InChI | InChI=1S/C6H8N2S/c9-5-3-6-7-1-2-8(6)4-5/h1-2,5,9H,3-4H2/t5-/m0/s1 |
| InChIKey | SVGHIJCMRDZNCP-YFKPBYRVSA-N |
| XLogP | 0.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol?
The IUPAC name of (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol (CID 10855545) is (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol.
What is the SMILES notation for (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol?
The canonical SMILES for (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol is S[C@H]1Cc2nccn2C1.
What is the InChIKey of (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol?
The InChIKey is SVGHIJCMRDZNCP-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8N2S/c9-5-3-6-7-1-2-8(6)4-5/h1-2,5,9H,3-4H2/t5-/m0/s1.
What are the key properties of (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol?
(6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol has a molecular weight of 140.21 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-6-thiol is sourced from PubChem (CID 10855545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).